| Products | Dicyclopentadiene |
| Other English name | 3a,4,7,7a-Tetrahydro-4,7-methanoindene; Cyclopentadiene dimer~3a,4,7,7a-Tetrahydro-4,7-methanoindene; DCPD; dicyclopentadiene (stabilized with bht); Dicyclopentadiene (>95%); Dicyclopentadiene (70%); Dicyopentadiene; Dicyclopentadiene (80%); Dicyclopentadiene dimer |
| CAS No. | 77-73-6 |
| EINECS No. | 201-052-9 |
| Molecular formula | C10H12 |
| Molecular weight | 132.2 |
| InChI | InChI=1/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2 |
| Melting point | -1ºC |
| Density | Relative density(water=1)0.98(3 |
| Boiling point | 170ºC |
| Flash point | 26ºC |
| Safety term | S36/37:;S61:; |
| Risk term | R11:;R20/22:;R36/37/38:;R51/53:; |
| Dangerous mark | F:Flammable;Xn:Harmful;N:Dangerous for the environment; |